-- Obfuscated by https Aspectnetwork net Obfuscator -- -- Version -- l

1
2
3
4
--// Obfuscated by https://Aspectnetwork.net/Obfuscator \\--
--// Version: 6 \\--
local demlol_llllIIllllIlIII='2d2d312561d9548a8f3e14a9f145dc69c839826b21db0c72000e00808a0f515abf10fbf049d5b5d06d7158f5e74b1320a3176cfb021895c9fffe7c94b8e62d36cbe2693617d2f9c67ca6a73f9c35161561a9e06e8a'local demlol_lIlllIIIlIIl='2f68f153c17ca95d4804207d70d48164585582ea30afe28152f71c0d6e06452ffd7c2d330428f01f6f0dff1ed2782dc8889e1a04a2073b26a4'local demlol_IllIllllIl=125;local demlol_lIIII=53;local demlol_IllIlll=1788547;local demlol_IIIIllIl=1594;local demlol_IIIlllIllIIIlI=function()local demlol_llllllIIllllllIllIllI='6c70b741f8acea6d47b8a876624ebffa82a1d1a88f36165146159043862209fc'local demlol_IIIIIl='5a55ecf935e788fd7e65b25efa17886e6156304e4d1702d59781357835569966b432102c'local demlol_lllIII='6a765dad2e229a97e1a30e0ff779c181c3e13da18eb8131041ed959a5a94a4a4c9'local demlol_lIlIlllllIIIlIlIlllI={MlqhRXQHk,FSNbRiNZmdwyGmQbMzX,WVxDJxOpVoCnHplw}end;local demlol_llllIllllIIIlIIIlII='41425d627d0fa07b7d40af6ae9882488c3b98f5a55a8104a69af21745c70a8c997b0b4173b045c8e0efd2aa9f5b3dc1ff88d0d6bb3c4a849a372b9bb737e4416'local demlol_IIllIIlIIIllIlllII=function()local demlol_IlIIIIlIIl='73762d8d1668948e3a3a3bf153e1f6c2d480cdebb4ccc22d4ac56a4c8297c71cfef89529f589a5e4a9a7332c5affe7259bb60545703010d148b0c358e904dee4b0e767bec1bfbb72'local demlol_IlIIIl='4a6297501aa5be2b83edc2f4db4f5abc5dce143a763fd14571dbc20c56ffc08865d67cbf627f9de02f4186dd0b8257f7efcc2f26a9fd729f2a4c5defca5647a3c8f3cdfce81a1760df7969ac'local demlol_llIlllI={nLVxGaY,oqNPidHYeNMfN}end;local demlol_IIlIllIlllIlllI=function()local demlol_lIlIlllIlI='51656436c4516b328687e69e70cf953b60fa320e5bdb19cfbf5a9d31bc91b28b538303cb47401a593e'local demlol_lIll='704e280033146eeb5ba6d5967d6ccc8182ab5f553aa73eb45d960b66176fd181ac9ef1c4aff6cf'local demlol_llllIlIIl='7a466262141c6dca94272b5db6d07a67cfb52f9bfc1173848e53531378e8397e380083027d3050f2b68547ef'local demlol_lIIlIIIllIIIIIIII='624ed589d6a51ac54a57abb3744cc7ec6bd6a7dc88f75ddc963fd47442dd78583f52b9e440c80de64831ca'local demlol_lllIlIIIIIIlIIIIllI={qlfNtWDYnCUdE,rQuJNcRpEVVqasZDdCdEet,gGdEaOUjYrykHwIMPrGj,bHDwqjdJpKEooYQMuJOCdbwXL}end;local demlol_lIIIlIlllIIlllllIIII=function()local demlol_IlI='644c79284e557db8ad2d8cb0833c299c076eafed5306e58cd0bad73b18836828e9fbe31bf2e31fd4c5fe7189eac2e119a0bc7d0cfda7d8ca39ab'local demlol_IllllIlllIII='6242086269ff3d9f30943a19b7c249d30e641f6ec186b886759a7386a5cf4a0b6026a9cd0d'local demlol_IIllIllIlllll={uSuPPNluGAoTeKiKkuR,eMgZsVhidUiaKBFWRlfLiJ}end;local demlol_IllIIlIlI='6e75d3701cef'local demlol_lIlllIlIlIlIlIIlll=function()local demlol_IIIllIIlllIlIlI='467011bf6dcb50178bf886ed1e7db8b0586fdb6316054dfa259e9dd85fb93f26a1c649069c17e56bc584c4bbb5050a4fe50d846fe8a5217738a95d79312b60ce32032e066df4'local demlol_lllIlIllIlIIIIIIIll='515380d9ef4bc9be574bc597e9cfbe3d91ef8d23d398efb38adad64b46c184c640f9ac25c622114c4c8039104b05defd458648d28563246d9c66'local demlol_IIlllIlllllllIIIlI='54762d33059e90dbb9bf350760ff0c2fb5cf3ebd19f8295484ada6e98f27d6c54b2b73e0342653025e4cb6f09d112872612dac05bba0ccc5051d10e49c19278f23621f841d016f48b22f7a29622075e34778eabc643c2cd2fc254ce682041564bfb0b7'local demlol_llIIlllIIllIIIIIlIll='424a0f28c20d2cc6c359d514fb612539d26a3ee7b3b60aa16b404ccfe38737db89636c36c49307feb8c7192ba5d30edc1f93294222a44304d6891338'local demlol_IIllIlIll='69567b12775630cd75ebca9f47abef27d56589adc44e565fc9b9600fb8480bac4af06dab9182564a6cb38fee08c3ef7de371e5d491c59c8be3f0d02e0cad722bfec6c34859b4fd42444f05100191373825f06791323c89d925e568'local demlol_IIlIIIlIllIllIIllIlI='467199eb4e07a9d8eeef07677511736303ca3c19565315635856bba59911ae514297b854e29eb09c994806ab3f6c9369a6fe406ebc32d14562bb6c63046ca2aaa16aeb728355141ffb78'local demlol_IlII='52680f24806c0cc73e3d6ff9ec74e8d8818ddebff0ab5473ba9db7a101f13986cb8f95f47e617da2a939e3cae10bff49fde5'local demlol_lIlllIII='735a3d9f5c0751c9f0e71726c80c4a78cc9983ad40b6efe65ce8e997b3b487c5334a7acb63058ab52ca9a370f4d4460b287bc167d5ea51683cfa3189'local demlol_IIlllIIlIIlIlIlIII={tLtVYqD,yGUKbQQiKcGkTxWeNtMdiw,JYbZyEhwDjGIlAyCrWd,nBaUqSfAxkLNkSHu,YmCeJ,MCBhBgofVPJsiQVrz,kupIDOTPUBeLopssRyavDX,rwCRlC}end;local demlol_llIllIlIIlIIIlIIII='756c5b128dba14'local demlol_llIlIIIlllIllIlIlIl=function()local demlol_IIllIlI='72654d4883b2e80d351397524f8ef2abbd0311aa3c59edb614caa422704fae4d057a1e47d48ad02202dbe314d40a129a2c3e28d41f1766ec4004a38b91e8ba2ed78cb3c2d00f54b20146377a8d492a641077d4baa1edd516f77e9053'local demlol_IllIIlIllIIIlllI='797208866d69fe6b49af770b89cd971984a20d910ae35d537c9d075702c6e19b2a8b4829e3392b64f98e51c79e332e22a1f39068ce3c94c71ea4a0f0ce6c661395'local demlol_lllIIllllIIIIlIIIIl='754808d9bb53fc9037c5d018f68cb37b5bd982e4d36737c4ad55b1e236cb0830ed0b1893995f1911b3abca1dbb30b9bd5b5c7afd3c5382c52d44b8ee28527b8ee62623c99ef1363e8984e114be7e6c6be817b17f48cf77f65359'local demlol_IIllllllllIl='757118826c666aaa37cad6c8f16e09d657ba6db13c5eca2dcdb690c5c1157eb10c780c9ecc83b07368ad91a0b8144ea92dc9f90fbc7757110eb685c48402'local demlol_llIIIlIIIlIllIIlllllIlll='7478461677476069c7c49832715d7b39ab7d075931719196aed29375e1794540e86e4551934b8e5c4755810773'local demlol_llIlI={KHqAhJWSbnZErOsWnwTqXrgk,FiKpwICjWrFFGbYpvYOoetWw,SoEyhMqBoYDKa,sHlPPsrZvE,sVLickPYgyYpNIWmjZXtQZgeL}end;local demlol_IlIIIIIIIlIIlll='6c65bc127bee'local demlol_IllIlIIIIlIlI=function()local demlol_IIIlIIIlIIll='7a4b87bc7a8bab00f8c5909e969fb4b4e30778542be798b622a8a0866dce242663248f98b27208f2b281213e7e8bb2781974fc3c77f7804c1d0d9fafd871d10d8beafa8d08bc0765b5dcd9b24c57415fa1032948e514f24327bf46b95bbe9c9795ad2fa7'local demlol_IlllllIllllIIIIlllII='786a99ad26d77d7ad7266d90de326f686d83f092925a878f8fb37364045314a89af31f6f9d74f5e9d0709b1087a31aa3d6276a954fea2bc5b6769095a103a0bde592928e6a964d0d'local demlol_lIlllI='4c4962773f7e632d05e625f316939e19225a0f0c170e0c5ddda2fed19d2e90f6d57d61b0d5600f21bb5657424168ce1e8e5b57d2cd8585'local demlol_lIlIIll='63671189477cd857d8655636a2db0e4296e4d007dfc6b0723bf62967cfa925051993a23c292c3560cde48c2282a43a8c6eba427245f602798b52b25b'local demlol_lIllllI='624ed3f954f8d43ef7e2e7e33968976c078cc835bfebeccc6607fb513e26ae0792bd12329e7cb3d4ab5b7fde371660dc1a22eb4063ee1e5fe829dcb71b29a548a3e773ae4802e5306c26adc827bacdab30f7bb3c70ab65333ea3524adf81bee745e355'local demlol_llllIIlllllIlIlIllIlI='4c785d28d2912ac85b53390b2a1b928dc6355f2ab0564a322ff7b5a9dbe8149664c02ac255f7c99859b03df3af533183cc281a0e6ca069'local demlol_IIIIIIllIlIIl='4d4faeceb47a13402cfba7c0fed42fcfbd8000caf0b8da05dd832199856c389a1daf7a226326d372f3de1786846b0459b17daa58b79e9e49e9012c52ef527973dc20e4042513'local demlol_IIIlIIll='72511f0f39ab2dbfcc1a91c39d2ba16b9cc1cf5e826a198b8f32cfc68253b4b618f1eff78bfe6b1af58faf9315d27db12177a3746ebd6d9bfd2b91ccc6cdce063617a12af15dd68f1a5ddf7bf9491f52b81352e71f7ef6abc7cdda78'local demlol_IIlIIlIlIlllII='6a4ff1f975f776f0f78f9a8ad36fe27c763ccaf556c4c275dcd91a829bbc9c62a6f459db8261a377e35c1592a1472a6867bb65eefd67bf015f89'local demlol_lIIlllllIIlIIlIlII='52666b2ff11c30709a24503af659a581d22ce9cbf3c9fa995ef354372cc5610ae8243a04aeecbf7cb2ff683dbe7220252ca5bd85e249efea0a15d24d72a0633fbe428d9a30001c44'local demlol_IlIIIIlIIIIlI={PtnLiVUsBUlj,HlDvJSqlgtPMKYa,FfNGueWTySfjB,LkPBAcLqaQfNal,BSaAr,KnpMnvvZDAMlS,iPJqXpBaTlAJmGeQpn,FTInlFsz,roHpNYiDmCpLcTL,hBuKOqNp}end;local demlol_IlIIlIlIIIIlIlIIIlIlI='45729e65db9b7e'local demlol_IIIlIlllIllIIllll=function()local demlol_llIllIlIIIIlIlIlIlII='4b5397417545d8eb99a95de37845667d61423a0fce3a4779b2f12069052c9deddf3f571208129526c1b5ef6f5de7b0c43061f5c47ded54'local demlol_lllIlllII='4561a0860dcd5aba4cd42b4da0b3af5c9d8162724cca596b0450f8de8c060252ef452c2cff3721471c9ce905308fe3452477bd77dfcefc34d558d99096a4cf14cb9510cf7166344f1b66600e942245975f77caf804b62aa3807840f8aa2e7b408594'local demlol_IllIllllIIllllIIllIIIIIIIlI='4368dc21297a8905820f7d0a2ca9126380dc4483fa0f243b9957444d3cbcccbbe68a5235284faf'local demlol_IIlllllllllllllI='6e61972104621e0ca817569cacb7a5935a0845d3742c0753dffc8275a596fd96a7ab'local demlol_lllIIllIIlIIIIIlIIII='65416986aba6225496a39b34f55efc655923690d1fe8f1ba59c75e273593ab1984'local demlol_IlIIll='577ad3506b335df8e13c3be287f377231ab2af5e90f117b271275fda4e4301d6f003012b125d615ce0da169d02395b6886b72620d1920d32b9834b917eb732deb4ad'local demlol_lllllIlIIllII='744116dc120aa49466829ff8214f8af4ffe9a8043991c3c4fdee1cc4e23c6ac7ad06e0a2491f'local demlol_lIIlll='686e8974bc7b279611cda634c8bb15219fd69204f664e5f58bba46128e9d95f1b9d574e8545ffb7d04faf1031532d0fc688bec2f0fdf'local demlol_IllllllI='6c6b8977b2c37ba8624a97db5e2ef9107ed31fa3571827d977e7627f06ba4055772caa69876303fa40fe52217fc7257bfd680ef6e08a64aa64484860b8ec5510c2430a58abff'local demlol_IIIllIlIIlIIIIl={tScNhZsqEMrJU,NCFEFrHsFXhpSiAlUthzCdh,lfNdJrFzNEwH,CuMWnGyOp,YxEBfBobFyJ,uyktNtWnLSQsdWfCqXCX,yEMAes,jGXvTskOhA,hHhAReKxCczZqMJj}end;local demlol_lllIllIlIllllII='556e2d9b84187bf49802df3450f0acc917c93769318b7893ea391f5f23eea6096b180586'local demlol_IIIIIIl='4f6e44bf968dd422d6ec5f3c11921eb2dff60033351753557b40'local demlol_llIIIlIIllIllllIlIl='4c751f1ea9c9f9863ed7f267dc4c112344cf965b870a'local demlol_IlllIllIIllIIll='5468978994a6503af4b9a659c493f13d930a9747158c3fc7e8b1f6b5'local demlol_llIllIlIlIIIIIlIIlI=function()local demlol_IIIIlIl='4a51467b11a14a2ea7a6bc0b18de94470ad2102482ab23f792940d4a3225c8b159b17485f628dfc54e1fba6c506822561b71c4534283d670fceeae43a715209c45e7765dade4f02e71433e171216d48c21306605c503867d2701'local demlol_IIIlIllllIIIIIllIllI='477828484dfa55da3384a8ba3a46c318dacca76e9786a54b970f0e300d9cf45b9474691bce36eac7b06ebe99e76cf4d767dd881389af06b32a3d4e0040'local demlol_llIIlIlIlIIIIlIIlll='4b74976267144c5157e4157c5985529b7d37f2d040c3c0c9ef6bb8074be4fabf373ac4dc057def698f9a59a093c65b16d9297c2a550e0442872d8fea85fdb8c2f50c64b5e207a8ea8fc536130356a01c738ac92b'local demlol_llIllIllIlII='4f747bf9042cd7cdd8dc50453d757ad56f1d0215379f5651ea5b8b0704ef45d759c8407c288f4693be258be927e9eec412d80c27924d9047982a4ecba102b8328024691ed0a6a5d6fe'local demlol_lIlIlIIIIII='795a08fd67ff21c486e7d76f8e6f36ab9646560fb1e833d65ae087e9aa65e8ced606cf76995242d90048e8992fe2996791a4c47a9552c42cec5107e3ea8c57b02f5121cedcc39b0f95f778aa70773ac6ac05e99a7a6a'local demlol_lIlIll={RIcpWlLl,nHmAlOLHEoft,TeOsEPvOu,vkAJtOpqAtRAiyLzGQwsVXdK,MaAMtaV}end;local demlol_IIlllIIIIlI;local demlol_IIIlIllIlIIIlIIll;local demlol_IIIIIIlIIIIIlIIll;local demlol_llll;local demlol_lI;local demlol_llIIlllI;local demlol_IIIIlIllllIIIlllIll;local demlol_IIlIIIIIlIlIlll;local demlol_lIllIllIllIIIIlllI;local demlol_lIIIlllIlIIIIlllllll;local demlol_lIlIIII=setmetatable;local demlol_lIllIllllIIlI=coroutine;local demlol_lIllIllIlllIllIlllIIl=demlol_lIllIllllIIlI.create;local demlol_IlllIlI=demlol_lIllIllllIIlI.resume;local demlol_lIIlllIIlIllllllI=string;local demlol_IlIIlllIIl=demlol_lIIlllIIlIllllllI.char;local demlol_IlllIllIllI=demlol_lIIlllIIlIllllllI.sub;local demlol_IlllIllIlllIIIIll=demlol_lIIlllIIlIllllllI.len;local demlol_IIllIIIlIIIIIIllll=getfenv;local demlol_IIIIlIlIlIIlIllll=tostring;local demlol_lIlIIIlIIllIlIllllI=tonumber;local demlol_IlIIlIlIlI;local demlol_lIllIIlIIIIlIlIlIIIll;local demlol_IllIIlIl;local demlol_lllllIIIllllII;local demlol_lIIIlIlIlllIlIl;local demlol_lIIlIIIlIlIllll=select;local demlol_llIIlllllIlIIll;local demlol_IIllllllIlI;local demlol_lIlIIIIl;local demlol_lllll;local demlol_IlIlIlIIlIlIlIIII;local demlol_lIIlIllIII;local demlol_lllIIlIIIlIII;local demlol_IIlIIlllIIlIIllIIl=function()local demlol_IlllIIlIllI='424136ad31d781ad2982b534e9ea229cc7261f67e6f67808ced593c0afd2bbf480aa93cee18af22a376ddb17249661170b58337983a4c8d70ae16f8496e7e090ed97c012e09b0f240051ff1621521def561282f1ba884fedc74a76540dfab188aa299b'local demlol_llIlllllIl='724f1641de5748410593bfe15642d97bf7c5e1889d4b7b66b3e87006304131ff6dec902ddcdf2fc3bb85d32860fd9ab4a089251272351be86f23ad5147494737ef2a2e2454d99a855e070a2d3960a28e'local demlol_IlllllIIIIlllll={TFnQap,MFuJZhPvfIyUm}end;demlol_lIIIlllIlIIIIlllllll=function(demlol_IIIllII)local demlol_lIlIlIlIIlIlllll,demlol_lllIIlllIIIIIlII=demlol_IllIlll,16384 +demlol_IIIIllIl;return(demlol_IIIllII:gsub('%x%x',function(demlol_IllIIlIIIlI)local demlol_IIIIlIlllIllllII=demlol_lIlIlIlIIlIlllll%274877906944;local demlol_llIllllIIIlII=(demlol_lIlIlIlIIlIlllll-demlol_IIIIlIlllIllllII)/274877906944;local demlol_IIIIIlllIIIIlIllII=demlol_llIllllIIIlII%128;demlol_IllIIlIIIlI=demlol_lIlIIIlIIllIlIllllI(demlol_IllIIlIIIlI,16)local demlol_llIIIlIl=(demlol_IllIIlIIIlI+ (demlol_llIllllIIIlII-demlol_IIIIIlllIIIIlIllII)/128)* (2 *demlol_IIIIIlllIIIIlIllII+1)%256;demlol_lIlIlIlIIlIlllll=demlol_IIIIlIlllIllllII*demlol_lllIIlllIIIIIlII+demlol_llIllllIIIlII+demlol_IllIIlIIIlI+demlol_llIIIlIl;return string.char(demlol_llIIIlIl)end))end;local demlol_IlllIlIII={}local demlol_lIlIlIIlIlIIIIlll={}local demlol_IIIlIIIIl={}local demlol_lIllIIlI={}for i=65,90 do demlol_IlllIlIII[demlol_lIIIlllIlIIIIlllllll(demlol_IllIIlIlI)..i]=i end;for i=97,122 do demlol_lIlIlIIlIlIIIIlll[demlol_lIIIlllIlIIIIlllllll(demlol_IllIIlIlI)..i]=i end;local demlol_IIl=function()local demlol_IllIIlIlIIlI='5477d594227d7a993db05adadb6ef8ef328bf7e72cbe673e0dd065f8126801052f7a5edb50ad6947e0c7c125ba9ac155730bdbce668d249c246614d947c482a0243f71d94a9a532048ac1aee8d0611095edf2e99'local demlol_llllll={USoKh}end;local demlol_IIIIIIlIIIllI=function(demlol_IIllIIlllIlllI,demlol_IIlllIlllIlI)demlol_IIIlIIIIl[demlol_lIIIlllIlIIIIlllllll(demlol_llIllIlIIlIIIlIIII)..demlol_IlIIlllIIl(demlol_IIlllIlllIlI)]=demlol_IlIIlllIIl(demlol_IIlllIlllIlI)end;local demlol_IIllIIlIIllIlIIIl=function(demlol_lIIIIlIlllIll,demlol_llIlIllIIlII)demlol_lIllIIlI[demlol_lIIIlllIlIIIIlllllll(demlol_IlIIIIIIIlIIlll)..demlol_IlIIlllIIl(demlol_llIlIllIIlII)]=demlol_IlIIlllIIl(demlol_llIlIllIIlII)end;table.foreach(demlol_IlllIlIII,demlol_IIIIIIlIIIllI)table.foreach(demlol_lIlIlIIlIlIIIIlll,demlol_IIllIIlIIllIlIIIl)local demlol_llllIIlIlIIlIllIII=function()local demlol_IllIlIlIllllll='5775d38d2c19d508e5bf451f9801971bef626a3c7c9bed08923e18d16a63699c2a804514fa724b5c6d8a6d910832ce'local demlol_llIIlIlIlllIllIIl='4270463300dc0ab1da0e4be8739e0f686137ecceb5c9bebd38cb44d62e94dbfff93be4a91174f579a698db19916c7d32aea4c655c684f463d2e2c8d333d6241e0a3b1bc1aed76e5e85a68c64'local demlol_IIlIl='5a6bec1d5fb3897e92910ed4a297261e10c1308c1e7a3eefa0a3358e1604cfb3eb9c'local demlol_IllIlllIIlIIllll='6a797b94901077288f63ce3b7840e0669f03427d82f32de3fef2b6631617bd9e63ec9318f241cc6c14e0f7ef3485fc1ba4a0ddd86212687916d26d1a025eb070cf6b211abb5cbd'local demlol_IIIllllllIllllllIIlllII='784a1fd91a5c35dfa9cf8580997e297dd6246971f22900a82d7353f44fc98084a0bea55e66ac3d6d5ecaaaa1cc353080d9e80310a8fb4f8260be0c20db3152a85416becde264142e878316bc011ab6adbeb2a098f2be608cfec2fb5438'local demlol_IIlIlIllI='6656d3b8230cec4f1c3776fafdfec028dd2317a151b6dbd964314a0bccc740fbfa91bce3b3c2fa35b43ba1900cff13e46e87ba8beefa47ceb36b8328810cbcdda6c7f43d50b46e0779a79f63ed79406d61942fca8f6f8fb100f1'local demlol_IIIIIllllIlIl='55702882c1206f0363c0cb3d3b677e3aeb59f934bf8c499d82f73889326fda1c5d1a3c14773db0c1a939f54adafe017650cf3544fa5d5f45ad50'local demlol_llIllllIlIIIIIIlIl={vdVqtNgbIUjRYgtXtOYE,XjQiLpIOgJaaODrDbQsiAmEl,ZCvLjHJBHCqvtzw,noWcTiZiMeCjJQbQ,QrKaHBqPcSxRhiNUpd,uTpXSmTzzVhHV,MzEjoNEBvEi}end;local demlol_lIlIIIIlIIIIII=demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterB..demlol_IIIlIIIIl.uletterC;local demlol_lIllIllllllIIlIIIll=demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterB..demlol_lIllIIlI.letterx;local demlol_lllIIIlIlllIIlIIll=demlol_IIIlIIIIl.uletterA..demlol_lIllIIlI.letters..demlol_IIIlIIIIl.uletterB..demlol_lIllIIlI.letterx;local demlol_Illllll=demlol_IIIlIIIIl.uletterM..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterV..demlol_IIIlIIIIl.uletterE;local demlol_lll=demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterD..demlol_IIIlIIIIl.uletterK;local demlol_llllllIllI=demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterD..demlol_IIIlIIIIl.uletterB..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterL;local demlol_lIIlIlIlIIIIlIllll=demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterD..demlol_IIIlIIIIl.uletterN..demlol_IIIlIIIIl.uletterI..demlol_IIIlIIIIl.uletterL;local demlol_lIIIlII=demlol_IIIlIIIIl.uletterG..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterU..demlol_IIIlIIIIl.uletterP..demlol_IIIlIIIIl.uletterV..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterL;local demlol_lllllIlIllIllIllI=demlol_IIIlIIIIl.uletterG..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterG..demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterB..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterL;local demlol_IlIllIllllIlIllllIIll=demlol_IIIlIIIIl.uletterG..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterB..demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterE;local demlol_llII=demlol_IIIlIIIIl.uletterS..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterG..demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterB..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterL;local demlol_IIIllIlll=demlol_IIIlIIIIl.uletterS..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterU..demlol_IIIlIIIIl.uletterP..demlol_IIIlIIIIl.uletterV..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterL;local demlol_IlllIlII=demlol_IIIlIIIIl.uletterS..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterB..demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterE;local demlol_IlIIl=demlol_IIIlIIIIl.uletterN..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterW..demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterB..demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterE;local demlol_llIllllIIlIII=demlol_IIIlIIIIl.uletterS..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterF;local demlol_IlIIlIllI=demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterD..demlol_IIIlIIIIl.uletterD;local demlol_llIlIIlllIllIIIlll=demlol_IIIlIIIIl.uletterS..demlol_IIIlIIIIl.uletterU..demlol_IIIlIIIIl.uletterB;local demlol_llIlIIIIlIllIIll=demlol_IIIlIIIIl.uletterM..demlol_IIIlIIIIl.uletterU..demlol_IIIlIIIIl.uletterL;local demlol_lllIIIIllIIIIIlI=demlol_IIIlIIIIl.uletterD..demlol_IIIlIIIIl.uletterI..demlol_IIIlIIIIl.uletterV;local demlol_IlIllIIlllIlllIIIl=demlol_IIIlIIIIl.uletterM..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterD;local demlol_llIIIIIIllIl=demlol_IIIlIIIIl.uletterP..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterW;local demlol_llllIl=demlol_IIIlIIIIl.uletterU..demlol_IIIlIIIIl.uletterN..demlol_IIIlIIIIl.uletterM;local demlol_IllIIIlllIIlIIlIIl=demlol_IIIlIIIIl.uletterN..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterT;local demlol_IIlllllllIllIllllIIlII=demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterN;local demlol_IlIIlIIIIIlll=demlol_IIIlIIIIl.uletterC..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterN..demlol_IIIlIIIIl.uletterC..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterT;local demlol_llIllllIl=demlol_IIIlIIIIl.uletterJ..demlol_IIIlIIIIl.uletterM..demlol_IIIlIIIIl.uletterP;local demlol_lIlll=demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterQ;local demlol_IIII=demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterT;local demlol_IIIIlIIlIlIIllIllIIIl=demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterE;local demlol_IIllllll=demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterS..demlol_IIIlIIIIl.uletterT;local demlol_IIIlIlllIlllIlllII=demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterS..demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterS..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterT;local demlol_IlIIIIlllllllIIlI=demlol_IIIlIIIIl.uletterC..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterL;local demlol_IlIllIIIlI=demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterI..demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterC..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterL;local demlol_lIIllIllIllIlllllI=demlol_IIIlIIIIl.uletterR..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterU..demlol_IIIlIIIIl.uletterR..demlol_IIIlIIIIl.uletterN;local demlol_Ill=demlol_IIIlIIIIl.uletterF..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterR..demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterP;local demlol_lIlllIIIIIllII=demlol_IIIlIIIIl.uletterF..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterR..demlol_IIIlIIIIl.uletterP..demlol_IIIlIIIIl.uletterR..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterP;local demlol_lIlIlIlIIllIlII=demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterF..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterR..demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterP;local demlol_llI=demlol_IIIlIIIIl.uletterS..demlol_IIIlIIIIl.uletterE..demlol_IIIlIIIIl.uletterT..demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterI..demlol_IIIlIIIIl.uletterS..demlol_IIIlIIIIl.uletterT;local demlol_IIlIlIllIlIlllII=demlol_IIIlIIIIl.uletterC..demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterS..demlol_IIIlIIIIl.uletterE;local demlol_lIIIlIllIllIlIIIl=demlol_IIIlIIIIl.uletterC..demlol_IIIlIIIIl.uletterL..demlol_IIIlIIIIl.uletterO..demlol_IIIlIIIIl.uletterS..demlol_IIIlIIIIl.uletterU..demlol_IIIlIIIIl.uletterR..demlol_IIIlIIIIl.uletterE;local demlol_IIIIIllIlIlllIl=demlol_IIIlIIIIl.uletterV..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterR..demlol_IIIlIIIIl.uletterA..demlol_IIIlIIIIl.uletterR..demlol_IIIlIIIIl.uletterG;local demlol_IllllllIllIIlIIIII={demlol_lIlIIIIlIIIIII,demlol_lIllIllllllIIlIIIll,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIllIllllllIIlIIIll,demlol_lIlIIIIlIIIIII,demlol_lIllIllllllIIlIIIll,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lllIIIlIlllIIlIIll,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lllIIIlIlllIIlIIll,demlol_lllIIIlIlllIIlIIll,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIlIIIIlIIIIII,demlol_lIllIllllllIIlIIIll,demlol_lIlIIIIlIIIIII}local demlol_lIIIlllIIIIllIIlll={demlol_Illllll,demlol_lll,demlol_llllllIllI,demlol_lIIlIlIlIIIIlIllll,demlol_lIIIlII,demlol_lllllIlIllIllIllI,demlol_IlIllIllllIlIllllIIll,demlol_llII,demlol_IIIllIlll,demlol_IlllIlII,demlol_IlIIl,demlol_llIllllIIlIII,demlol_IlIIlIllI,demlol_llIlIIlllIllIIIlll,demlol_llIlIIIIlIllIIll,demlol_lllIIIIllIIIIIlI,demlol_IlIllIIlllIlllIIIl,demlol_llIIIIIIllIl,demlol_llllIl,demlol_IllIIIlllIIlIIlIIl,demlol_IIlllllllIllIllllIIlII,demlol_IlIIlIIIIIlll,demlol_llIllllIl,demlol_lIlll,demlol_IIII,demlol_IIIIlIIlIlIIllIllIIIl,demlol_IIllllll,demlol_IIIlIlllIlllIlllII,demlol_IlIIIIlllllllIIlI,demlol_IlIllIIIlI,demlol_lIIllIllIllIlllllI,demlol_Ill,demlol_lIlllIIIIIllII,demlol_lIlIlIlIIllIlII,demlol_llI,demlol_IIlIlIllIlIlllII,demlol_lIIIlIllIllIlIIIl,demlol_IIIIIllIlIlllIl}local demlol_IlllllIIIIIIlIIlllIIl=function()local demlol_lIlIIllIIIIIlIlIII='6d4d1662e7d4bdf8a819b12b30e95090d1b183f83fb4c1f9c7b6882da0f2'local demlol_IllIIlllIIllllllllll='6856ccaae5474541360c70774ddbbb948d506c43cf4d34e94115bb896666d40060a6c4087cf9112accb4f820179dc88ff070c64c90ef7627fe5c511d04018c611ddd46fc4eafcf21ac25d04835b2f5afb444'local demlol_IllIIIIllIlll='71431674578ddcbd6b71fc36718d1b1cf4c4934471c132898a9ce0e9f35c0f0304223c6396c2958c6918d016b8867e724b8c9a703b1f5f9e8a3ce66dc13ab61f005b4cfd72f04b3cbbd4c5772f171a435ee2c30570a0ec3457188e'local demlol_lIlllllIIIIlI={riSYttcCvChBLrKlYArEE,UOncMcG,JYHmIJwQUiEDvqhubAzqU}end;demlol_IIllllllIlI=function(demlol_IIIlIlIIIlIlIlIllI)local demlol_lllIIlIlI=tonumber(demlol_IIIlIlIIIlIlIlIllI)local demlol_IIIlIllIIllIllIl=''for i=7,0,-1 do local demlol_llIIlIIIIlIIl=math.pow(2,i)if demlol_lllIIlIlI>=demlol_llIIlIIIIlIIl then demlol_IIIlIllIIllIllIl=demlol_IIIlIllIIllIllIl..'1'demlol_lllIIlIlI=demlol_lllIIlIlI-demlol_llIIlIIIIlIIl else demlol_IIIlIllIIllIllIl=demlol_IIIlIllIIllIllIl..'0'end end;return demlol_IIIlIllIIllIllIl end;demlol_lIlIIIIl=function(demlol_IIIIIllIlIIll)return tonumber(demlol_IIIIIllIlIIll,2)end;demlol_lllll=function(demlol_llIlllllllIlIIIIllIll)local demlol_llIIIIIIIIIll=demlol_llIlllllllIlIIIIllIll:gsub("%s","")local demlol_llllIllIIllIlIIll=demlol_llIIIIIIIIIll:gsub("=","")local demlol_lllIIIl=''local demlol_llIIlIlIlIIl=''for i=1,demlol_IlllIllIlllIIIIll(demlol_llllIllIIllIlIIll)do local demlol_IIIIIIllIIIlllI=demlol_IlllIllIllI(demlol_llIlllllllIlIIIIllIll,i,i)local demlol_IIIlIllllIIIIllllll,demlol_lIIIIllIIIlIIIIlll=string.find(demlol_lIIIlllIlIIIIlllllll(demlol_llllIllllIIIlIIIlII),demlol_IIIIIIllIIIlllI)if demlol_IIIlIllllIIIIllllll==nil then error("Invalid character '"..demlol_IIIIIIllIIIlllI.."' found.")end;demlol_lllIIIl=demlol_lllIIIl..demlol_IlllIllIllI(demlol_IIllllllIlI(demlol_IIIlIllllIIIIllllll-1),3)end;for i=1,demlol_IlllIllIlllIIIIll(demlol_lllIIIl),8 do local demlol_llllllIl=demlol_IlllIllIllI(demlol_lllIIIl,i,i+7)demlol_llIIlIlIlIIl=demlol_llIIlIlIlIIl..demlol_IlIIlllIIl(demlol_lIlIIIIl(demlol_llllllIl))end;local demlol_lIIIII=demlol_llIIIIIIIIIll:len()-demlol_llllIllIIllIlIIll:len()if(demlol_lIIIII==1 or demlol_lIIIII==2)then demlol_llIIlIlIlIIl=demlol_llIIlIlIlIIl:sub(1,-2)end;return demlol_llIIlIlIlIIl end;demlol_llIIlllllIlIIll=function(demlol_IIIllllIIlIlIIllIlIl)print(demlol_IIIllllIIlIlIIllIlIl)end;demlol_IllIIlIl=function(demlol_llIIll)local demlol_lIIlllIlIIllIIlI={}local demlol_IIIlllIllIII=setmetatable({},demlol_lIIlllIlIIllIIlI)function demlol_lIIlllIlIIllIIlI:__index(demlol_IIlIlIlIlIllIlllIII)local demlol_IlIIllII=demlol_llIIll(demlol_IIlIlIlIlIllIlllIII)demlol_IIIlllIllIII[demlol_IIlIlIlIlIllIlllIII]=demlol_IlIIllII;return demlol_IlIIllII end;return demlol_IIIlllIllIII end;demlol_lllllIIIllllII=function(demlol_lIlllllIlIIllll,demlol_lIIlllIIlIIllII)local function demlol_IIIlIIllIllllI(demlol_lllIIIllllII,demlol_llIIIIlI)local demlol_lIlIllI,demlol_IlIlI=0,1;while demlol_lllIIIllllII~=0 and demlol_llIIIIlI~=0 do local demlol_lllI,demlol_lIIlIIlIlIlI=demlol_lllIIIllllII%demlol_lIIlllIIlIIllII,demlol_llIIIIlI%demlol_lIIlllIIlIIllII;demlol_lIlIllI=demlol_lIlIllI+demlol_lIlllllIlIIllll[demlol_lllI][demlol_lIIlIIlIlIlI]*demlol_IlIlI;demlol_lllIIIllllII=(demlol_lllIIIllllII-demlol_lllI)/demlol_lIIlllIIlIIllII;demlol_llIIIIlI=(demlol_llIIIIlI-demlol_lIIlIIlIlIlI)/demlol_lIIlllIIlIIllII;demlol_IlIlI=demlol_IlIlI*demlol_lIIlllIIlIIllII end;demlol_lIlIllI=demlol_lIlIllI+ (demlol_lllIIIllllII+demlol_llIIIIlI)*demlol_IlIlI;return demlol_lIlIllI end;return demlol_IIIlIIllIllllI end;demlol_lIIIlIlIlllIlIl=function(demlol_lIIllIIllIlllIlIIIl)local demlol_lllllIl=demlol_lllllIIIllllII(demlol_lIIllIIllIlllIlIIIl,2 ^1)local demlol_IlIllIllIllIlIIlIlIll=demlol_IllIIlIl(function(demlol_IIIIlIIIIIIIIllIlIlIIIll)return demlol_IllIIlIl(function(demlol_lIIlIIIIIlIlIlll)return demlol_lllllIl(demlol_IIIIlIIIIIIIIllIlIlIIIll,demlol_lIIlIIIIIlIlIlll)end)end)return demlol_lllllIIIllllII(demlol_IlIllIllIllIlIIlIlIll,2 ^ (demlol_lIIllIIllIlllIlIIIl.n or 1))end;demlol_lIllIIlIIIIlIlIlIIIll=demlol_lIIIlIlIlllIlIl{[0]={[0]=0,[1]=1},[1]={[0]=1,[1]=0},n=4}demlol_IlIIlIlIlI=function(demlol_IIlIlIllIllII,demlol_lIIllIIlIllll,demlol_IlIlIIllIIl,...)local demlol_lIIlll;if demlol_lIIllIIlIllll then demlol_IIlIlIllIllII=demlol_IIlIlIllIllII%2 ^32;demlol_lIIllIIlIllll=demlol_lIIllIIlIllll%2 ^32;demlol_lIIlll=demlol_lIllIIlIIIIlIlIlIIIll(demlol_IIlIlIllIllII,demlol_lIIllIIlIllll)if demlol_IlIlIIllIIl then demlol_lIIlll=demlol_IlIIlIlIlI(demlol_lIIlll,demlol_IlIlIIllIIl,...)end;return demlol_lIIlll elseif demlol_IIlIlIllIllII then return demlol_IIlIlIllIllII%MOD else return 0 end end;demlol_IlIlIlIIlIlIlIIII=function(demlol_lllIlllIII,demlol_IIllIIIlIlIIllIlIII,demlol_IIlllllllIIlIIIIIl)if demlol_IIlllllllIIlIIIIIl then local demlol_IIIlIIIlIIIl=0;local demlol_IlIIIllII=0;for i=demlol_IIllIIIlIlIIllIlIII,demlol_IIlllllllIIlIIIIIl do demlol_IIIlIIIlIIIl=demlol_IIIlIIIlIIIl+2 ^demlol_IlIIIllII*demlol_IlIlIlIIlIlIlIIII(demlol_lllIlllIII,i)demlol_IlIIIllII=demlol_IlIIIllII+1 end;return demlol_IIIlIIIlIIIl else local demlol_IlIIIIlIlIllIllIIIIII=2 ^ (demlol_IIllIIIlIlIIllIlIII-1)return(demlol_lllIlllIII% (demlol_IlIIIIlIlIllIllIIIIII+demlol_IlIIIIlIlIllIllIIIIII)>=demlol_IlIIIIlIlIllIllIIIIII)and 1 or 0 end end;demlol_lIIlIllIII=function(demlol_lIllI)local demlol_llllIIIIIllIIll=1;local demlol_lllIlIllIlIIIIlI=''local demlol_llIlllllIIlIlI;local demlol_llIIIlIIIIIll=''if(demlol_lIllI==nil)then error("Nil inputs.")else local demlol_lIIlIlIlll=1;while demlol_lIIlIlIlll<#demlol_lIllI+1 do local demlol_IIlIIlI=demlol_IlllIllIllI(demlol_lIllI,demlol_lIIlIlIlll,demlol_lIIlIlIlll+3)local demlol_IlllllllIIll=demlol_lllll(demlol_IIlIIlI)local demlol_lIlllllllllllIllIIIl=demlol_IIIIlIllllIIIlllIll(demlol_IlllllllIIll,demlol_lIIII)local demlol_lIllIlIIllllllllIII=demlol_IIlIIIIIlIlIlll(demlol_lIlllllllllllIllIIIl,demlol_IllIllllIl)demlol_llIIIlIIIIIll=demlol_llIIIlIIIIIll..demlol_IlIIlllIIl(demlol_lIllIlIIllllllllIII)demlol_lIIlIlIlll=demlol_lIIlIlIlll+4 end end;local demlol_IllllIIIIllIllIllI=1;local demlol_lIlIlIlIIllIII=false;local demlol_IIIIIlIlIllllIlllIlIl;local demlol_llIllllIllIIIlIllIIII;local demlol_IIlIIllIllIlI,demlol_IIIIIllIIIlI;local demlol_IIllIlllIIll,demlol_lllIIIIlIIIIlIIlllIlI,demlol_IlllIlIl,demlol_lllI,demlol_llIlllIlIlIlIIll;do function demlol_IIllIlllIIll()local demlol_IlIIlllIIlIIIllI=demlol_llIIIlIIIIIll:byte(demlol_IllllIIIIllIllIllI,demlol_IllllIIIIllIllIllI)demlol_IllllIIIIllIllIllI=demlol_IllllIIIIllIllIllI+1;return demlol_IlIIlllIIlIIIllI end;function demlol_lllIIIIlIIIIlIIlllIlI()local demlol_lIllIIllllIlII,demlol_llIlIIlIlllIlll,demlol_Illll,demlol_IllIlllI=demlol_llIIIlIIIIIll:byte(demlol_IllllIIIIllIllIllI,demlol_IllllIIIIllIllIllI+3)demlol_IllllIIIIllIllIllI=demlol_IllllIIIIllIllIllI+4;return demlol_IllIlllI*16777216 +demlol_Illll*65536 +demlol_llIlIIlIlllIlll*256 +demlol_lIllIIllllIlII end;function demlol_IlllIlIl()local demlol_IIlllIl=demlol_lllIIIIlIIIIlIIlllIlI()local demlol_IllIIlllllIllllIIIII=demlol_lllIIIIlIIIIlIIlllIlI()return demlol_IllIIlllllIllllIIIII*4294967296 +demlol_IIlllIl end;function demlol_lllI()local demlol_llIIlIllllllllII=demlol_lllIIIIlIIIIlIIlllIlI()local demlol_llIIIllIIIlIIlI=demlol_lllIIIIlIIIIlIIlllIlI()return(-2 *demlol_IlIlIlIIlIlIlIIII(demlol_llIIIllIIIlIIlI,32)+1)* (2 ^ (demlol_IlIlIlIIlIlIlIIII(demlol_llIIIllIIIlIIlI,21,31)-1023))* ( (demlol_IlIlIlIIlIlIlIIII(demlol_llIIIllIIIlIIlI,1,20)* (2 ^32)+demlol_llIIlIllllllllII)/ (2 ^52)+1)end;function demlol_llIlllIlIlIlIIll(demlol_IIlllllIIlIIlIllII)local demlol_lIIIIIlllIIII;if demlol_IIlllllIIlIIlIllII then demlol_lIIIIIlllIIII=demlol_llIIIlIIIIIll:sub(demlol_IllllIIIIllIllIllI,demlol_IllllIIIIllIllIllI+demlol_IIlllllIIlIIlIllII-1)demlol_IllllIIIIllIllIllI=demlol_IllllIIIIllIllIllI+demlol_IIlllllIIlIIlIllII else demlol_IIlllllIIlIIlIllII=demlol_IIIIIllIIIlI()if demlol_IIlllllIIlIIlIllII==0 then return end;demlol_lIIIIIlllIIII=demlol_llIIIlIIIIIll:sub(demlol_IllllIIIIllIllIllI,demlol_IllllIIIIllIllIllI+demlol_IIlllllIIlIIlIllII-1)demlol_IllllIIIIllIllIllI=demlol_IllllIIIIllIllIllI+demlol_IIlllllIIlIIlIllII end;return demlol_lIIIIIlllIIII end end;local function demlol_llIllIllllIlIIIlIIll()local demlol_IIlIl;local demlol_llIlllIIIIlIIlllllll={}local demlol_lIIlIlllIllllIllll={}local demlol_llIIIIlIIlIIIIII={}local demlol_llIIIlIlIlIIlIllllIll={lines={}}demlol_IIlIl={instructions=demlol_llIlllIIIIlIIlllllll,constants=demlol_lIIlIlllIllllIllll,prototypes=demlol_llIIIIlIIlIIIIII,debug=demlol_llIIIlIlIlIIlIllllIll}local demlol_IIIlll;demlol_IIlIl.name=demlol_llIlllIlIlIlIIll()demlol_IIlIl.first_line=demlol_IIlIIllIllIlI()demlol_IIlIl.last_line=demlol_IIlIIllIllIlI()if demlol_IIlIl.name then demlol_IIlIl.name=demlol_IIlIl.name:sub(1,-2)end;demlol_IIlIl.upvalues=demlol_IIllIlllIIll()demlol_IIlIl.arguments=demlol_IIllIlllIIll()demlol_IIlIl.varg=demlol_IIllIlllIIll()demlol_IIlIl.stack=demlol_IIllIlllIIll()do demlol_IIIlll=demlol_IIlIIllIllIlI()for i=1,demlol_IIIlll do local demlol_llllll={}local demlol_llllIIllIIIIlIllII=demlol_lllIIIIlIIIIlIIlllIlI()local demlol_IllIlIlIlII=demlol_IlIlIlIIlIlIlIIII(demlol_llllIIllIIIIlIllII,1,6)local demlol_IIIIII=demlol_IllllllIllIIlIIIII[demlol_IllIlIlIlII+1]demlol_llllll.opcode=demlol_IllIlIlIlII;demlol_llllll.type=demlol_IIIIII;demlol_llllll.A=demlol_IlIlIlIIlIlIlIIII(demlol_llllIIllIIIIlIllII,7,14)if demlol_IIIIII=="ABC"then demlol_llllll.B=demlol_IlIlIlIIlIlIlIIII(demlol_llllIIllIIIIlIllII,24,32)demlol_llllll.C=demlol_IlIlIlIIlIlIlIIII(demlol_llllIIllIIIIlIllII,15,23)elseif demlol_IIIIII=="ABx"then demlol_llllll.Bx=demlol_IlIlIlIIlIlIlIIII(demlol_llllIIllIIIIlIllII,15,32)elseif demlol_IIIIII=="AsBx"then demlol_llllll.sBx=demlol_IlIlIlIIlIlIlIIII(demlol_llllIIllIIIIlIllII,15,32)-131071 end;demlol_llIlllIIIIlIIlllllll[i]=demlol_llllll end end;do demlol_IIIlll=demlol_IIlIIllIllIlI()for i=1,demlol_IIIlll do local demlol_lIIIIlIIllIIIIlIIlll={}local demlol_llllIIlIl=demlol_IIllIlllIIll()demlol_lIIIIlIIllIIIIlIIlll.type=demlol_llllIIlIl;if demlol_llllIIlIl==1 then demlol_lIIIIlIIllIIIIlIIlll.data=(demlol_IIllIlllIIll()~=0)elseif demlol_llllIIlIl==3 then demlol_lIIIIlIIllIIIIlIIlll.data=demlol_lllI()elseif demlol_llllIIlIl==4 then demlol_lIIIIlIIllIIIIlIIlll.data=demlol_llIlllIlIlIlIIll():sub(1,-2)end;demlol_lIIlIlllIllllIllll[i-1]=demlol_lIIIIlIIllIIIIlIIlll end end;do demlol_IIIlll=demlol_IIlIIllIllIlI()for i=1,demlol_IIIlll do demlol_llIIIIlIIlIIIIII[i-1]=demlol_llIllIllllIlIIIlIIll()end end;do local demlol_llllIlIll=demlol_llIIIlIlIlIIlIllllIll.lines;demlol_IIIlll=demlol_IIlIIllIllIlI()for i=1,demlol_IIIlll do demlol_llllIlIll[i]=demlol_lllIIIIlIIIIlIIlllIlI()end;demlol_IIIlll=demlol_IIlIIllIllIlI()for i=1,demlol_IIIlll do demlol_llIlllIlIlIlIIll():sub(1,-2)demlol_lllIIIIlIIIIlIIlllIlI()demlol_lllIIIIlIIIIlIIlllIlI()end;demlol_IIIlll=demlol_IIlIIllIllIlI()for i=1,demlol_IIIlll do demlol_llIlllIlIlIlIIll()end end;return demlol_IIlIl end;do assert(demlol_llIlllIlIlIlIIll(4)=="\27Lua",demlol_lIIIlllIlIIIIlllllll(demlol_llIIIlIIllIllllIlIl))assert(demlol_IIllIlllIIll()==0x51,demlol_lIIIlllIlIIIIlllllll(demlol_IIIIIIl))demlol_IIllIlllIIll()demlol_lIlIlIlIIllIII=(demlol_IIllIlllIIll()==0)demlol_IIIIIlIlIllllIlllIlIl=demlol_IIllIlllIIll()demlol_llIllllIllIIIlIllIIII=demlol_IIllIlllIIll()if demlol_IIIIIlIlIllllIlllIlIl==4 then demlol_IIlIIllIllIlI=demlol_lllIIIIlIIIIlIIlllIlI elseif demlol_IIIIIlIlIllllIlllIlIl==8 then demlol_IIlIIllIllIlI=demlol_IlllIlIl else error(demlol_lllIllIlIllllII)end;if demlol_llIllllIllIIIlIllIIII==4 then demlol_IIIIIllIIIlI=demlol_lllIIIIlIIIIlIIlllIlI elseif demlol_llIllllIllIIIlIllIIII==8 then demlol_IIIIIllIIIlI=demlol_IlllIlIl else error(demlol_lIIIlllIlIIIIlllllll(demlol_lllIllIlIllllII))end;assert(demlol_llIlllIlIlIlIIll(3)=="\4\8\0",demlol_lllIllIlIllllII)end;return demlol_llIllIllllIlIIIlIIll()end;local function demlol_IlllIIlllllIIlIlll(...)local demlol_lllllllII=select("#",...)local demlol_IIIIIIIlllIll={...}return demlol_lllllllII,demlol_IIIIIIIlllIll end;demlol_lllIIlIIIlIII=function(demlol_lIllIllIlIllIlIIlllll,demlol_IllllIIIIIlIllllIIlI)local demlol_IlIIIIIIIIII=demlol_lIllIllIlIllIlIIlllll.instructions;local demlol_llllllIllIlIIII=demlol_lIllIllIlIllIlIIlllll.constants;local demlol_IIlllIlll=demlol_lIllIllIlIllIlIIlllll.prototypes;local demlol_llIII,demlol_lIlIlllIIllI;local demlol_IlIllIIIIlIIlIllIlIll;local demlol_IIllllIllIlII=1;local demlol_IllllIIIl,demlol_llllIllllllIIIIllIIII;local demlol_lIIIIIIIIIlIIIlI={[0]=function(demlol_llllIllllIlllllllIll)demlol_llIII[demlol_llllIllllIlllllllIll.A]=demlol_llIII[demlol_llllIllllIlllllllIll.B]end,[1]=function(demlol_lllllIIlIIllII)demlol_llIII[demlol_lllllIIlIIllII.A]=demlol_llllllIllIlIIII[demlol_lllllIIlIIllII.Bx].data end,[2]=function(demlol_IIllIIIIlIIlIlIIlllIl)demlol_llIII[demlol_IIllIIIIlIIlIlIIlllIl.A]=demlol_IIllIIIIlIIlIlIIlllIl.B~=0;if demlol_IIllIIIIlIIlIlIIlllIl.C~=0 then demlol_IIllllIllIlII=demlol_IIllllIllIlII+1 end end,[3]=function(demlol_lllII)local demlol_llIIIl=demlol_llIII;for i=demlol_lllII.A,demlol_lllII.B do demlol_llIIIl[i]=nil end end,[4]=function(demlol_lIIIIlIlIIlIllIl)demlol_llIII[demlol_lIIIIlIlIIlIllIl.A]=demlol_IllllIIIIIlIllllIIlI[demlol_lIIIIlIlIIlIllIl.B]end,[5]=function(demlol_lII)local demlol_IlllIlIlllIIllIIIIII=demlol_llllllIllIlIIII[demlol_lII.Bx].data;demlol_llIII[demlol_lII.A]=demlol_IlIllIIIIlIIlIllIlIll[demlol_IlllIlIlllIIllIIIIII]end,[6]=function(demlol_lIlllllIlIIllIllIllI)local demlol_IllllIIIllIlIllI=demlol_lIlllllIlIIllIllIllI.C;local demlol_lIlI=demlol_llIII;demlol_IllllIIIllIlIllI=demlol_IllllIIIllIlIllI>255 and demlol_llllllIllIlIIII[demlol_IllllIIIllIlIllI-256].data or demlol_lIlI[demlol_IllllIIIllIlIllI]demlol_lIlI[demlol_lIlllllIlIIllIllIllI.A]=demlol_lIlI[demlol_lIlllllIlIIllIllIllI.B][demlol_IllllIIIllIlIllI]end,[7]=function(demlol_lllllIllll)local demlol_lIllllIlIllIII=demlol_llllllIllIlIIII[demlol_lllllIllll.Bx].data;demlol_IlIllIIIIlIIlIllIlIll[demlol_lIllllIlIllIII]=demlol_llIII[demlol_lllllIllll.A]end,[8]=function(demlol_IIlIIIIllI)demlol_IllllIIIIIlIllllIIlI[demlol_IIlIIIIllI.B]=demlol_llIII[demlol_IIlIIIIllI.A]end,[9]=function(demlol_lIlIlIlllIlI)local demlol_lIIlllIlIl=demlol_lIlIlIlllIlI.B;local demlol_lllIIIIIlIIIl=demlol_lIlIlIlllIlI.C;local demlol_IllIlllIIIllIlIllllI,demlol_IlIIIIlIllIlIllIIlI=demlol_llIII,demlol_llllllIllIlIIII;demlol_lIIlllIlIl=demlol_lIIlllIlIl>255 and demlol_IlIIIIlIllIlIllIIlI[demlol_lIIlllIlIl-256].data or demlol_IllIlllIIIllIlIllllI[demlol_lIIlllIlIl]demlol_lllIIIIIlIIIl=demlol_lllIIIIIlIIIl>255 and demlol_IlIIIIlIllIlIllIIlI[demlol_lllIIIIIlIIIl-256].data or demlol_IllIlllIIIllIlIllllI[demlol_lllIIIIIlIIIl]demlol_IllIlllIIIllIlIllllI[demlol_lIlIlIlllIlI.A][demlol_lIIlllIlIl]=demlol_lllIIIIIlIIIl end,[10]=function(demlol_IllIllIlIIlIllII)demlol_llIII[demlol_IllIllIlIIlIllII.A]={}end,[11]=function(demlol_IlIlIIIllIlllIIIIlIl)local demlol_llIlIIIllllIlIIlIlI=demlol_IlIlIIIllIlllIIIIlIl.A;local demlol_llIIIlIllIlllIIIIll=demlol_IlIlIIIllIlllIIIIlIl.B;local demlol_IIIlIl=demlol_IlIlIIIllIlllIIIIlIl.C;local demlol_lllIlllllIIlIIlI=demlol_llIII;demlol_llIIIlIllIlllIIIIll=demlol_lllIlllllIIlIIlI[demlol_llIIIlIllIlllIIIIll]demlol_IIIlIl=demlol_IIIlIl>255 and demlol_llllllIllIlIIII[demlol_IIIlIl-256].data or demlol_lllIlllllIIlIIlI[demlol_IIIlIl]demlol_lllIlllllIIlIIlI[demlol_llIlIIIllllIlIIlIlI+1]=demlol_llIIIlIllIlllIIIIll;demlol_lllIlllllIIlIIlI[demlol_llIlIIIllllIlIIlIlI]=demlol_llIIIlIllIlllIIIIll[demlol_IIIlIl]end,[12]=function(demlol_IIIIIlIIIlIlllIIl)local demlol_llIlIIllIIlllllIIlllIIl=demlol_IIIIIlIIIlIlllIIl.B;local demlol_llIlllIllIIlllIlIllIl=demlol_IIIIIlIIIlIlllIIl.C;local demlol_IllIlIIIIlIl,demlol_lIlllIlIllllIIllI=demlol_llIII,demlol_llllllIllIlIIII;demlol_llIlIIllIIlllllIIlllIIl=demlol_llIlIIllIIlllllIIlllIIl>255 and demlol_lIlllIlIllllIIllI[demlol_llIlIIllIIlllllIIlllIIl-256].data or demlol_IllIlIIIIlIl[demlol_llIlIIllIIlllllIIlllIIl]demlol_llIlllIllIIlllIlIllIl=demlol_llIlllIllIIlllIlIllIl>255 and demlol_lIlllIlIllllIIllI[demlol_llIlllIllIIlllIlIllIl-256].data or demlol_IllIlIIIIlIl[demlol_llIlllIllIIlllIlIllIl]demlol_IllIlIIIIlIl[demlol_IIIIIlIIIlIlllIIl.A]=demlol_llIlIIllIIlllllIIlllIIl+demlol_llIlllIllIIlllIlIllIl end,[13]=function(demlol_lllI)local demlol_IIIlIlIlIllIIl=demlol_lllI.B;local demlol_lllllllIIIIlllllIII=demlol_lllI.C;local demlol_llIIIIlIlIIIlllllII,demlol_lllIlllllllIlII=demlol_llIII,demlol_llllllIllIlIIII;demlol_IIIlIlIlIllIIl=demlol_IIIlIlIlIllIIl>255 and demlol_lllIlllllllIlII[demlol_IIIlIlIlIllIIl-256].data or demlol_llIIIIlIlIIIlllllII[demlol_IIIlIlIlIllIIl]demlol_lllllllIIIIlllllIII=demlol_lllllllIIIIlllllIII>255 and demlol_lllIlllllllIlII[demlol_lllllllIIIIlllllIII-256].data or demlol_llIIIIlIlIIIlllllII[demlol_lllllllIIIIlllllIII]demlol_llIIIIlIlIIIlllllII[demlol_lllI.A]=demlol_IIIlIlIlIllIIl-demlol_lllllllIIIIlllllIII end,[14]=function(demlol_llIlIllIllIllIl)local demlol_IIlIIIIllIIlIIlIIlI=demlol_llIlIllIllIllIl.B;local demlol_lIlIlIlIIIl=demlol_llIlIllIllIllIl.C;local demlol_IIllIIlIIlIlIll,demlol_lIIIIIIlIlIl=demlol_llIII,demlol_llllllIllIlIIII;demlol_IIlIIIIllIIlIIlIIlI=demlol_IIlIIIIllIIlIIlIIlI>255 and demlol_lIIIIIIlIlIl[demlol_IIlIIIIllIIlIIlIIlI-256].data or demlol_IIllIIlIIlIlIll[demlol_IIlIIIIllIIlIIlIIlI]demlol_lIlIlIlIIIl=demlol_lIlIlIlIIIl>255 and demlol_lIIIIIIlIlIl[demlol_lIlIlIlIIIl-256].data or demlol_IIllIIlIIlIlIll[demlol_lIlIlIlIIIl]demlol_IIllIIlIIlIlIll[demlol_llIlIllIllIllIl.A]=demlol_IIlIIIIllIIlIIlIIlI*demlol_lIlIlIlIIIl end,[15]=function(demlol_IlllllIlIIIIll)local demlol_IlllIIl=demlol_IlllllIlIIIIll.B;local demlol_IIIIIIIlIlllllllIllll=demlol_IlllllIlIIIIll.C;local demlol_IlIIlIlIIIllIllIllllIlIIll,demlol_IlIIIIIlIIllIlIlIl=demlol_llIII,demlol_llllllIllIlIIII;demlol_IlllIIl=demlol_IlllIIl>255 and demlol_IlIIIIIlIIllIlIlIl[demlol_IlllIIl-256].data or demlol_IlIIlIlIIIllIllIllllIlIIll[demlol_IlllIIl]demlol_IIIIIIIlIlllllllIllll=demlol_IIIIIIIlIlllllllIllll>255 and demlol_IlIIIIIlIIllIlIlIl[demlol_IIIIIIIlIlllllllIllll-256].data or demlol_IlIIlIlIIIllIllIllllIlIIll[demlol_IIIIIIIlIlllllllIllll]demlol_IlIIlIlIIIllIllIllllIlIIll[demlol_IlllllIlIIIIll.A]=demlol_IlllIIl/demlol_IIIIIIIlIlllllllIllll end,[16]=function(demlol_lllIIl)local demlol_lIlIIlIllIl=demlol_lllIIl.B;local demlol_lIll=demlol_lllIIl.C;local demlol_lllllllIIIIllIIlllI,demlol_IlllllIlIllIl=demlol_llIII,demlol_llllllIllIlIIII;demlol_lIlIIlIllIl=demlol_lIlIIlIllIl>255 and demlol_IlllllIlIllIl[demlol_lIlIIlIllIl-256].data or demlol_lllllllIIIIllIIlllI[demlol_lIlIIlIllIl]demlol_lIll=demlol_lIll>255 and demlol_IlllllIlIllIl[demlol_lIll-256].data or demlol_lllllllIIIIllIIlllI[demlol_lIll]demlol_lllllllIIIIllIIlllI[demlol_lllIIl.A]=demlol_lIlIIlIllIl%demlol_lIll end,[17]=function(demlol_IlI)local demlol_lIllllIlllIlIIII=demlol_IlI.B;local demlol_llllIlIllllIlIIlII=demlol_IlI.C;local demlol_lIlIlIlIIIIlIl,demlol_lIllllIIllllll=demlol_llIII,demlol_llllllIllIlIIII;demlol_lIllllIlllIlIIII=demlol_lIllllIlllIlIIII>255 and demlol_lIllllIIllllll[demlol_lIllllIlllIlIIII-256].data or demlol_lIlIlIlIIIIlIl[demlol_lIllllIlllIlIIII]demlol_llllIlIllllIlIIlII=demlol_llllIlIllllIlIIlII>255 and demlol_lIllllIIllllll[demlol_llllIlIllllIlIIlII-256].data or demlol_lIlIlIlIIIIlIl[demlol_llllIlIllllIlIIlII]demlol_lIlIlIlIIIIlIl[demlol_IlI.A]=demlol_lIllllIlllIlIIII^demlol_llllIlIllllIlIIlII end,[18]=function(demlol_IIIIllIII)demlol_llIII[demlol_IIIIllIII.A]=-demlol_llIII[demlol_IIIIllIII.B]end,[19]=function(demlol_IIIlIIIIlIIlIl)demlol_llIII[demlol_IIIlIIIIlIIlIl.A]=not demlol_llIII[demlol_IIIlIIIIlIIlIl.B]end,[20]=function(demlol_IIIlII)demlol_llIII[demlol_IIIlII.A]=#demlol_llIII[demlol_IIIlII.B]end,[21]=function(demlol_IlIIlIlllIllIIl)local demlol_IlllIIllIlIII=demlol_IlIIlIlllIllIIl.B;local demlol_llIlIIIllIIll=demlol_llIII[demlol_IlllIIllIlIII]for i=demlol_IlllIIllIlIII+1,demlol_IlIIlIlllIllIIl.C do demlol_llIlIIIllIIll=demlol_llIlIIIllIIll..demlol_llIII[i]end;demlol_llIII[demlol_IlIIlIlllIllIIl.A]=demlol_llIlIIIllIIll end,[22]=function(demlol_llIIllIllllIlIIl)demlol_IIllllIllIlII=demlol_IIllllIllIlII+demlol_llIIllIllllIlIIl.sBx end,[23]=function(demlol_llIllIIlIIIlIlIlIlI)local demlol_lIlIlIIlIIll=demlol_llIllIIlIIIlIlIlIlI.A;local demlol_IlllIlIlIII=demlol_llIllIIlIIIlIlIlIlI.B;local demlol_lIllIlIl=demlol_llIllIIlIIIlIlIlIlI.C;local demlol_IIlIl,demlol_llllIIlll=demlol_llIII,demlol_llllllIllIlIIII;demlol_lIlIlIIlIIll=demlol_lIlIlIIlIIll~=0;demlol_IlllIlIlIII=demlol_IlllIlIlIII>255 and demlol_llllIIlll[demlol_IlllIlIlIII-256].data or demlol_IIlIl[demlol_IlllIlIlIII]demlol_lIllIlIl=demlol_lIllIlIl>255 and demlol_llllIIlll[demlol_lIllIlIl-256].data or demlol_IIlIl[demlol_lIllIlIl]if(demlol_IlllIlIlIII==demlol_lIllIlIl)~=demlol_lIlIlIIlIIll then demlol_IIllllIllIlII=demlol_IIllllIllIlII+1 end end,[24]=function(demlol_IIllllIIlIIlIIIIII)local demlol_IllllIIllIIlIllI=demlol_IIllllIIlIIlIIIIII.A;local demlol_lIIIIIIlIlIllIllI=demlol_IIllllIIlIIlIIIIII.B;local demlol_IIIlllllIIIIlI=demlol_IIllllIIlIIlIIIIII.C;local demlol_lIIlllII,demlol_IlllllIlIlllIlIIIII=demlol_llIII,demlol_llllllIllIlIIII;demlol_IllllIIllIIlIllI=demlol_IllllIIllIIlIllI~=0;demlol_lIIIIIIlIlIllIllI=demlol_lIIIIIIlIlIllIllI>255 and demlol_IlllllIlIlllIlIIIII[demlol_lIIIIIIlIlIllIllI-256].data or demlol_lIIlllII[demlol_lIIIIIIlIlIllIllI]demlol_IIIlllllIIIIlI=demlol_IIIlllllIIIIlI>255 and demlol_IlllllIlIlllIlIIIII[demlol_IIIlllllIIIIlI-256].data or demlol_lIIlllII[demlol_IIIlllllIIIIlI]if(demlol_lIIIIIIlIlIllIllI<demlol_IIIlllllIIIIlI)~=demlol_IllllIIllIIlIllI then demlol_IIllllIllIlII=demlol_IIllllIllIlII+1 end end,[25]=function(demlol_IIIllIlIIlIIII)local demlol_lIlIllIlIIIIIllIlIl=demlol_IIIllIlIIlIIII.A;local demlol_IIlIlIlI=demlol_IIIllIlIIlIIII.B;local demlol_lIlllIIlIlIll=demlol_IIIllIlIIlIIII.C;local demlol_lIllIIllllllII,demlol_IIIllIl=demlol_llIII,demlol_llllllIllIlIIII;demlol_lIlIllIlIIIIIllIlIl=demlol_lIlIllIlIIIIIllIlIl~=0;demlol_IIlIlIlI=demlol_IIlIlIlI>255 and demlol_IIIllIl[demlol_IIlIlIlI-256].data or demlol_lIllIIllllllII[demlol_IIlIlIlI]demlol_lIlllIIlIlIll=demlol_lIlllIIlIlIll>255 and demlol_IIIllIl[demlol_lIlllIIlIlIll-256].data or demlol_lIllIIllllllII[demlol_lIlllIIlIlIll]if(demlol_IIlIlIlI<=demlol_lIlllIIlIlIll)~=demlol_lIlIllIlIIIIIllIlIl then demlol_IIllllIllIlII=demlol_IIllllIllIlII+1 end end,[26]=function(demlol_IIIIIlIlIIIll)if(not not demlol_llIII[demlol_IIIIIlIlIIIll.A])== (demlol_IIIIIlIlIIIll.C==0)then demlol_IIllllIllIlII=demlol_IIllllIllIlII+1 end end,[27]=function(demlol_lllIlIllIIII)local demlol_llIIIll=demlol_llIII;local demlol_IIlIllllI=demlol_llIIIll[demlol_lllIlIllIIII.B]if(not not demlol_IIlIllllI)== (demlol_lllIlIllIIII.C==0)then demlol_IIllllIllIlII=demlol_IIllllIllIlII+1 else demlol_llIIIll[demlol_lllIlIllIIII.A]=demlol_IIlIllllI end end,[28]=function(demlol_llIlIlIllIlI)local demlol_lllIllll=demlol_llIlIlIllIlI.A;local demlol_lIlIlII=demlol_llIlIlIllIlI.B;local demlol_lIIlllllI=demlol_llIlIlIllIlI.C;local demlol_IIIlIllIIlIIIllIlIlIIlI=demlol_llIII;local demlol_IIlIIIlIIIlII,demlol_lIlIlllIllIIl;local demlol_lIIlI,demlol_IlIlIlIlIlIlIIIIIlllIIllIlI;demlol_IIlIIIlIIIlII={}if demlol_lIlIlII~=1 then if demlol_lIlIlII~=0 then demlol_lIIlI=demlol_lllIllll+demlol_lIlIlII-1 else demlol_lIIlI=demlol_lIlIlllIIllI end;demlol_IlIlIlIlIlIlIIIIIlllIIllIlI=0;for i=demlol_lllIllll+1,demlol_lIIlI do demlol_IlIlIlIlIlIlIIIIIlllIIllIlI=demlol_IlIlIlIlIlIlIIIIIlllIIllIlI+1;demlol_IIlIIIlIIIlII[demlol_IlIlIlIlIlIlIIIIIlllIIllIlI]=demlol_IIIlIllIIlIIIllIlIlIIlI[i]end;demlol_lIIlI,demlol_lIlIlllIllIIl=demlol_IlllIIlllllIIlIlll(demlol_IIIlIllIIlIIIllIlIlIIlI[demlol_lllIllll](unpack(demlol_IIlIIIlIIIlII,1,demlol_lIIlI-demlol_lllIllll)))else demlol_lIIlI,demlol_lIlIlllIllIIl=demlol_IlllIIlllllIIlIlll(demlol_IIIlIllIIlIIIllIlIlIIlI[demlol_lllIllll]())end;demlol_lIlIlllIIllI=demlol_lllIllll-1;if demlol_lIIlllllI~=1 then if demlol_lIIlllllI~=0 then demlol_lIIlI=demlol_lllIllll+demlol_lIIlllllI-2 else demlol_lIIlI=demlol_lIIlI+demlol_lllIllll end;demlol_IlIlIlIlIlIlIIIIIlllIIllIlI=0;for i=demlol_lllIllll,demlol_lIIlI do demlol_IlIlIlIlIlIlIIIIIlllIIllIlI=demlol_IlIlIlIlIlIlIIIIIlllIIllIlI+1;demlol_IIIlIllIIlIIIllIlIlIIlI[i]=demlol_lIlIlllIllIIl[demlol_IlIlIlIlIlIlIIIIIlllIIllIlI]end end end,[29]=function(demlol_IIlllII)local demlol_IIlIlIIIIlllIlIIl=demlol_IIlllII.A;local demlol_lIlIl=demlol_IIlllII.B;local demlol_IIIllIlIIllIIlllIIIl=demlol_IIlllII.C;local demlol_lllIIllI=demlol_llIII;local demlol_lIlIIIIIlIllIIIIllIlI,demlol_llIIIIIllIllIIlIIlllI;local demlol_IllIIII,demlol_IlIIlIll,demlol_IIllIlllIlIIllIIl=demlol_lIlIlllIIllI;demlol_lIlIIIIIlIllIIIIllIlI={}if demlol_lIlIl~=1 then if demlol_lIlIl~=0 then demlol_IlIIlIll=demlol_IIlIlIIIIlllIlIIl+demlol_lIlIl-1 else demlol_IlIIlIll=demlol_IllIIII end;demlol_IIllIlllIlIIllIIl=0;for i=demlol_IIlIlIIIIlllIlIIl+1,demlol_IlIIlIll do demlol_IIllIlllIlIIllIIl=demlol_IIllIlllIlIIllIIl+1;demlol_lIlIIIIIlIllIIIIllIlI[#demlol_lIlIIIIIlIllIIIIllIlI+1]=demlol_lllIIllI[i]end;demlol_llIIIIIllIllIIlIIlllI={demlol_lllIIllI[demlol_IIlIlIIIIlllIlIIl](unpack(demlol_lIlIIIIIlIllIIIIllIlI,1,demlol_IlIIlIll-demlol_IIlIlIIIIlllIlIIl))}else demlol_llIIIIIllIllIIlIIlllI={demlol_lllIIllI[demlol_IIlIlIIIIlllIlIIl]()}end;return true,demlol_llIIIIIllIllIIlIIlllI end,[30]=function(demlol_lIlllIlllIll)local demlol_llIIlIIlIIll=demlol_lIlllIlllIll.A;local demlol_llIIll=demlol_lIlllIlllIll.B;local demlol_IllIlIlIllllIIIIlI=demlol_llIII;local demlol_IlIllIlIllIlIII;local demlol_IIIIIlIlllIlIIIl,demlol_IIllIlIIIIlII;if demlol_llIIll==1 then return true end;if demlol_llIIll==0 then demlol_IlIllIlIllIlIII=demlol_lIlIlllIIllI else demlol_IlIllIlIllIlIII=demlol_llIIlIIlIIll+demlol_llIIll-2 end;demlol_IIllIlIIIIlII={}local demlol_lllllIl=0;for i=demlol_llIIlIIlIIll,demlol_IlIllIlIllIlIII do demlol_lllllIl=demlol_lllllIl+1;demlol_IIllIlIIIIlII[demlol_lllllIl]=demlol_IllIlIlIllllIIIIlI[i]end;return true,demlol_IIllIlIIIIlII end,[31]=function(demlol_IIIIllllIIlIlIIllllI)local demlol_lIIIIIllI=demlol_IIIIllllIIlIlIIllllI.A;local demlol_IIlllIllllIIIlI=demlol_llIII;local demlol_IIlIlIl=demlol_IIlllIllllIIIlI[demlol_lIIIIIllI+2]local demlol_IllIlIIIIlII=demlol_IIlllIllllIIIlI[demlol_lIIIIIllI]+demlol_IIlIlIl;demlol_IIlllIllllIIIlI[demlol_lIIIIIllI]=demlol_IllIlIIIIlII;if demlol_IIlIlIl>0 then if demlol_IllIlIIIIlII<=demlol_IIlllIllllIIIlI[demlol_lIIIIIllI+1]then demlol_IIllllIllIlII=demlol_IIllllIllIlII+demlol_IIIIllllIIlIlIIllllI.sBx;demlol_IIlllIllllIIIlI[demlol_lIIIIIllI+3]=demlol_IllIlIIIIlII end else if demlol_IllIlIIIIlII>=demlol_IIlllIllllIIIlI[demlol_lIIIIIllI+1]then demlol_IIllllIllIlII=demlol_IIllllIllIlII+demlol_IIIIllllIIlIlIIllllI.sBx;demlol_IIlllIllllIIIlI[demlol_lIIIIIllI+3]=demlol_IllIlIIIIlII end end end,[32]=function(demlol_IlIlIIIllIllIIll)local demlol_lIlllllIIlIlIllIllI=demlol_IlIlIIIllIllIIll.A;local demlol_lIlIlIlIllI=demlol_llIII;demlol_lIlIlIlIllI[demlol_lIlllllIIlIlIllIllI]=demlol_lIlIlIlIllI[demlol_lIlllllIIlIlIllIllI]-demlol_lIlIlIlIllI[demlol_lIlllllIIlIlIllIllI+2]demlol_IIllllIllIlII=demlol_IIllllIllIlII+demlol_IlIlIIIllIllIIll.sBx end,[33]=function(demlol_IIllIlll)local demlol_IIIIIlIIIlIIIlIlIII=demlol_IIllIlll.A;local demlol_lllIlllllIl=demlol_IIllIlll.B;local demlol_IlIIllIlIIlIII=demlol_IIllIlll.C;local demlol_IlllI=demlol_llIII;local demlol_IIllIlIIIIlII=demlol_IIIIIlIIIlIIIlIlIII+2;local demlol_IlIlIllllllIIIlllIl={demlol_IlllI[demlol_IIIIIlIIIlIIIlIlIII](demlol_IlllI[demlol_IIIIIlIIIlIIIlIlIII+1],demlol_IlllI[demlol_IIIIIlIIIlIIIlIlIII+2])}for i=1,demlol_IlIIllIlIIlIII do demlol_IlllI[demlol_IIllIlIIIIlII+i]=demlol_IlIlIllllllIIIlllIl[i]end;if demlol_IlllI[demlol_IIIIIlIIIlIIIlIlIII+3]~=nil then demlol_IlllI[demlol_IIIIIlIIIlIIIlIlIII+2]=demlol_IlllI[demlol_IIIIIlIIIlIIIlIlIII+3]else demlol_IIllllIllIlII=demlol_IIllllIllIlII+1 end end,[34]=function(demlol_IllIII)local demlol_llIIlIIlIllI=demlol_IllIII.A;local demlol_lIIlIlIl=demlol_IllIII.B;local demlol_IlIllIIIIllIIllI=demlol_IllIII.C;local demlol_IlIIIllI=demlol_llIII;if demlol_IlIllIIIIllIIllI==0 then error("Something went wrong here....")else local demlol_lIIl=(demlol_IlIllIIIIllIIllI-1)*50;local demlol_IllII=demlol_IlIIIllI[demlol_llIIlIIlIllI]if demlol_lIIlIlIl==0 then demlol_lIIlIlIl=demlol_lIlIlllIIllI end;for i=1,demlol_lIIlIlIl do demlol_IllII[demlol_lIIl+i]=demlol_IlIIIllI[demlol_llIIlIIlIllI+i]end end end,[35]=function(demlol_llIIlIl)end,[36]=function(demlol_lIlIIlllIIlI)local demlol_llIllIlIIIIllllIIIll=demlol_IIlllIlll[demlol_lIlIIlllIIlI.Bx]local demlol_lllIII=demlol_IlIIIIIIIIII;local demlol_llIIIIIl=demlol_llIII;local demlol_llIll={}local demlol_IIIllIIlIllllIlIlllIl=demlol_lIlIIII({},{__index=function(demlol_IIlIlllllIlIlIlIll,demlol_IlllIIlIlllIllIlIll)local demlol_IlllllllIIl=demlol_llIll[demlol_IlllIIlIlllIllIlIll]return demlol_IlllllllIIl.segment[demlol_IlllllllIIl.offset]end,__newindex=function(demlol_IIllIlIIllIIlIIII,demlol_IllllIIIllIlIIlIlllIII,demlol_lIllIIIIIIlllIll)local demlol_llllIIIIIlll=demlol_llIll[demlol_IllllIIIllIlIIlIlllIII]demlol_llllIIIIIlll.segment[demlol_llllIIIIIlll.offset]=demlol_lIllIIIIIIlllIll end})for i=1,demlol_llIllIlIIIIllllIIIll.upvalues do local demlol_lIIIIIIIIIllIllllIlIII=demlol_lllIII[demlol_IIllllIllIlII]if demlol_lIIIIIIIIIllIllllIlIII.opcode==0 then demlol_llIll[i-1]={segment=demlol_llIIIIIl,offset=demlol_lIIIIIIIIIllIllllIlIII.B}elseif demlol_lllIII[demlol_IIllllIllIlII].opcode==4 then demlol_llIll[i-1]={segment=demlol_IllllIIIIIlIllllIIlI,offset=demlol_lIIIIIIIIIllIllllIlIII.B}end;demlol_IIllllIllIlII=demlol_IIllllIllIlII+1 end;local demlol_lllIllIIllII,demlol_IlIIllllIIIllI=demlol_lllIIlIIIlIII(demlol_llIllIlIIIIllllIIIll,demlol_IIIllIIlIllllIlIlllIl)demlol_llIIIIIl[demlol_lIlIIlllIIlI.A]=demlol_IlIIllllIIIllI end,[37]=function(demlol_llllIllllIIl)local demlol_IIlIlIIlIIIlIl=demlol_llllIllllIIl.A;local demlol_lIIIIlIll=demlol_llllIllllIIl.B;local demlol_IlllIIlIllIIIIII,demlol_lIIlllllIlIlIlllIl=demlol_llIII,demlol_IllllIIIl;for i=demlol_IIlIlIIlIIIlIl,demlol_IIlIlIIlIIIlIl+ (demlol_lIIIIlIll>0 and demlol_lIIIIlIll-1 or demlol_llllIllllllIIIIllIIII)do demlol_IlllIIlIllIIIIII[i]=demlol_lIIlllllIlIlIlllIl[i-demlol_IIlIlIIlIIIlIl]end end}local function demlol_IlllIIII(demlol_IIlllI)local demlol_lIIIlllIlIIIIIIIIIll=demlol_lIllIllIlIllIlIIlllll.name;local demlol_IIlIIllIllIIlIIlll=demlol_lIllIllIlIllIlIIlllll.debug.lines[demlol_IIllllIllIlII]local demlol_lllllI=(demlol_IIlllI:match("^.+:(.+)")or demlol_IIlllI)local demlol_llIllIlllI=demlol_IlIIlIlIIIIlIlIIIlIlI;if demlol_lIIIlllIlIIIIIIIIIll then demlol_llIllIlllI=demlol_lIIIlllIlIIIIIIIIIll end;if demlol_IIlIIllIllIIlIIlll then demlol_llIllIlllI=demlol_llIllIlllI.." - Line: "..demlol_IIlIIllIllIIlIIlll end;if demlol_IIlllI and type(demlol_IIlllI)=="string"then demlol_llIllIlllI=demlol_llIllIlllI.." - Error: "..demlol_lllllI end;if demlol_llll then demlol_llll(demlol_IIIIlIlIlIIlIllll(demlol_IIlIIllIllIIlIIlll)..":"..demlol_IIIIlIlIlIIlIllll(demlol_lllllI))else error(demlol_IIIIlIlIlIIlIllll(demlol_IIlIIllIllIIlIIlll)..":"..demlol_IIIIlIlIlIIlIllll(demlol_lllllI),3)end end;local function demlol_lIlllllllIIl()local demlol_lIlIIIIlIIIlIllIIllII=demlol_IlIIIIIIIIII;local demlol_lIIIlIllllII,demlol_llIIIIIlllll,demlol_IlllIIlIIII,demlol_lIllIlIIl;while true do demlol_lIIIlIllllII=demlol_lIlIIIIlIIIlIllIIllII[demlol_IIllllIllIlII]demlol_IIllllIllIlII=demlol_IIllllIllIlII+1;demlol_lIllIlIIl,demlol_llIIIIIlllll,demlol_IlllIIlIIII=pcall(function()return demlol_lIIIIIIIIIlIIIlI[demlol_lIIIlIllllII.opcode](demlol_lIIIlIllllII)end)if not demlol_lIllIlIIl then demlol_IlllIIII(demlol_llIIIIIlllll)break elseif demlol_llIIIIIlllll then return demlol_IlllIIlIIII end end end;local demlol_IlIlIlIIIlIl={}local function demlol_IlIIlIIIl(...)local demlol_IIIIl={}local demlol_IllIIIIIIllIIIIlIII={}demlol_lIlIlllIIllI=-1;demlol_llIII=demlol_lIlIIII(demlol_IIIIl,{__index=demlol_IllIIIIIIllIIIIlIII,__newindex=function(demlol_lllIllIlIllIIlI,demlol_IlIIllllll,demlol_IIIIlIIlIIII)if demlol_IlIIllllll>demlol_lIlIlllIIllI and demlol_IIIIlIIlIIII then demlol_lIlIlllIIllI=demlol_IlIIllllll end;demlol_IllIIIIIIllIIIIlIII[demlol_IlIIllllll]=demlol_IIIIlIIlIIII end})local demlol_lIllIlIlIIllllIIlIIl={...}demlol_IllllIIIl={}demlol_llllIllllllIIIIllIIII=select("#",...)-1;for i=0,demlol_llllIllllllIIIIllIIII do demlol_IIIIl[i]=demlol_lIllIlIlIIllllIIlIIl[i+1]demlol_IllllIIIl[i]=demlol_lIllIlIlIIllllIIlIIl[i+1]end;demlol_IlIllIIIIlIIlIllIlIll=demlol_IIIIIIlIIIIIlIIll or demlol_IIllIIIlIIIIIIllll()demlol_IIllllIllIlII=1;local demlol_IIIllII=demlol_lIllIllIlllIllIlllIIl(demlol_lIlllllllIIl)local demlol_lIIIlIIIlIIlIlI,demlol_IIlIIlIlIIIlIllIlll=demlol_IlllIlI(demlol_IIIllII)if demlol_lIIIlIIIlIIlIlI then if demlol_IIlIIlIlIIIlIllIlll then return unpack(demlol_IIlIIlIlIIIlIllIlll)end;return else if demlol_IIIlIllIlIIIlIIll then else demlol_IlllIIII(demlol_IIlIIlIlIIIlIllIlll)end end end;return demlol_IlIlIlIIIlIl,demlol_IlIIlIIIl end;demlol_IIIIlIllllIIIlllIll=function(demlol_llIlIIlIIllIllllI,demlol_lIIlIIl)return demlol_IlIIlIlIlI(demlol_llIlIIlIIllIllllI,demlol_lIIlIIl)end;demlol_IIlIIIIIlIlIlll=function(demlol_lIIlIlllIlIllIlIlIllIIll,demlol_IllllIlllIlIl)return demlol_IlIIlIlIlI(demlol_lIIlIlllIlIllIlIlIllIIll,demlol_IllllIlllIlIl)end;demlol_lI=function(demlol_IlI,demlol_llllllIlllI,demlol_llllllllIIlIIlIIIl)demlol_IIIIIIlIIIIIlIIll=demlol_llllllIlllI or demlol_IIllIIIlIIIIIIllll(2)demlol_llll=demlol_llllllllIIlIIlIIIl;local demlol_llllIllllllllIII=demlol_lIIlIllIII(demlol_IlI)local demlol_lIlIIlIlIllIIlIlII,demlol_IllIIIlllIlIllIl=demlol_lllIIlIIIlIII(demlol_llllIllllllllIII)return demlol_IllIIIlllIlIllIl end;local demlol_IllIIIIlIIllIllII=function()local demlol_IlIlIllIllIIlIllII='5355807bf8af851fdb6dd839d552a49618cb0d85223b0fd328c1909adcc3d737b73fe5919341661ef5184672a3aa3ca2005b5b24'local demlol_lllIIIlllIl='4f6fce9f1b744d77bbb345b61b3b37b454c58a5e01dc5a4343a80189fd966ddf0b28af073e17c6'local demlol_IllllIIIIIIIIlIlIIll='6d42b5fd536887788025d6a21419b07c7aac0f6f55266c88c9fdf75d1cd4c874d323bbc364a7296edbf70d35cceb582b5bf2a0e41c3265a40116831e5bf79f7960ed15'local demlol_IlllIllIll='42517bbf56fe05b5e372782249fbb6ba3503626c8861863be476c9ae4fb1de72f8f1f11856174c6024f944b1ea1def78f15b7bcbc8e246b1e95d60237ac6dea6382276'local demlol_IIllIlIlIllIIlIIllll='53730af9921fd43343822424e957158a99a2999a72cfe555b2e43286d9ab2185cf72fd02ce4e3ad1b2877006cdd22043ecfc95127a5e2f2540520195d85931c41ef5d0'local demlol_llIlIl='6f703dadd5fb9495393fe598c7b598db6eff677b69f48ab3eb70200bd09d43665c2132666958dffe4ec7e9999e5c8bbcb7b8ae0191a23c67dd83253956e335068ee13993450a7e68cfbca1f9e980cbfd4cd4c741'local demlol_IlIllI='64595b894ec105d55b1f87cef835825be15c8806a7f6092d429fea2056ffee4d77b885d968'local demlol_lIIl={fmMvXyDnHAhCFbCy,NdEgLRvkG,ECcdMOGaMtzl,JlASEnxrS,FCekTRyTv,EIsYij,iTopAhBFoAzEvW}end;return demlol_lI('\ODM=\NA==\NjE=\NDE=\MjU=\NzI=\NzM=\NzY=\NjQ=\NzY=\NjQ=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzQ=\Njc=\OTU=\NzI=\NzI=\NzI=\Nzc=\NzI=\NzI=\NzI=\MTM=\OA==\NzI=\NzI=\Mw==\MjAw\MTM2\NzI=\MjA=\NzI=\NzI=\NzM=\ODQ=\NzI=\NzM=\NzI=\OTQ=\OA==\NzU=\MjAw\Mw==\MTM3\OA==\NzQ=\MTM3\NzM=\NzM=\NzI=\MjA=\MjAx\MjAw\NzM=\MTg=\NzM=\NzI=\NzI=\OTQ=\NzI=\NzQ=\MjAw\MTM=\OQ==\NzM=\NzI=\MjA1\OQ==\NzM=\NzI=\MTM2\NzM=\MjAw\NzM=\NzM=\MjAy\NzM=\NzI=\Mw==\MTM4\OQ==\NzQ=\MjA=\MjAy\NzI=\NzM=\MTU3\OQ==\MjAy\NzU=\MjEy\NzM=\NzI=\NzM=\MjA=\OQ==\NzI=\NzI=\MTA1\MjAw\NzI=\NzI=\OTQ=\MTM2\MTc5\NTU=\ODY=\NzI=\MjAw\NzI=\NjQ=\NzI=\NzI=\NzI=\NzY=\Nzg=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NTY=\NDE=\MzM=\NTg=\NTk=\NzI=\NzY=\Nzc=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NDc=\NDE=\Mzc=\NDU=\NzI=\NzY=\NzE=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\MTU=\NDU=\NjA=\MTI=\NDU=\NTk=\NDM=\NDU=\Mzg=\NDQ=\NDE=\Mzg=\NjA=\NTk=\NzI=\NzY=\NzY=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\MQ==\NTk=\OQ==\NzI=\NzY=\Njg=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\MjY=\NDU=\Mzc=\Mzk=\NjA=\NDU=\MTM=\NjI=\NDU=\Mzg=\NjA=\NzI=\NzY=\Nzg=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NTY=\NTg=\MzM=\Mzg=\NjA=\NzI=\NzY=\NzQ=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\MTA0\NzI=\NzY=\Njg=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\MTU=\NDU=\NjA=\MTQ=\NjE=\MzY=\MzY=\Ng==\NDE=\Mzc=\NDU=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=\NzI=',demlol_IIllIIIlIIIIIIllll())()